C16H10Cl3NO3 — CID 8802639
[4-(cyanomethyl)phenyl] 2-(2,4,5-trichlorophenoxy)acetate (PubChem CID 8802639) has the molecular formula C16H10Cl3NO3 and a molecular weight of 370.62 g/mol. Its IUPAC name is [4-(cyanomethyl)phenyl] 2-(2,4,5-trichlorophenoxy)acetate.
| Compound Name | [4-(cyanomethyl)phenyl] 2-(2,4,5-trichlorophenoxy)acetate |
|---|---|
| PubChem CID | 8802639 |
| Molecular Formula | C16H10Cl3NO3 |
| Molecular Weight | 370.62 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | [4-(cyanomethyl)phenyl] 2-(2,4,5-trichlorophenoxy)acetate |
| SMILES | N#CCc1ccc(OC(=O)COc2cc(Cl)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C16H10Cl3NO3/c17-12-7-14(19)15(8-13(12)18)22-9-16(21)23-11-3-1-10(2-4-11)5-6-20/h1-4,7-8H,5,9H2 |
| InChIKey | NCFRYJQHWFPCMV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.62 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|