C15H20N2O6S — CID 8808144
[2-oxo-2-[[(1R)-1-(4-sulfamoylphenyl)ethyl]amino]ethyl] (2S)-oxolane-2-carboxylate (PubChem CID 8808144) has the molecular formula C15H20N2O6S and a molecular weight of 356.40 g/mol. Its IUPAC name is [2-oxo-2-[[(1R)-1-(4-sulfamoylphenyl)ethyl]amino]ethyl] (2S)-oxolane-2-carboxylate.
| Compound Name | [2-oxo-2-[[(1R)-1-(4-sulfamoylphenyl)ethyl]amino]ethyl] (2S)-oxolane-2-carboxylate |
|---|---|
| PubChem CID | 8808144 |
| Molecular Formula | C15H20N2O6S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | [2-oxo-2-[[(1R)-1-(4-sulfamoylphenyl)ethyl]amino]ethyl] (2S)-oxolane-2-carboxylate |
| SMILES | C[C@@H](NC(=O)COC(=O)[C@@H]1CCCO1)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H20N2O6S/c1-10(11-4-6-12(7-5-11)24(16,20)21)17-14(18)9-23-15(19)13-3-2-8-22-13/h4-7,10,13H,2-3,8-9H2,1H3,(H,17,18)(H2,16,20,21)/t10-,13+/m1/s1 |
| InChIKey | KSHJXIGYBUBYAB-MFKMUULPSA-N |
| XLogP | 0.23 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |