C23H26N2O3 — CID 8817690
[(2R)-1-oxo-1-[[(1R)-1-phenylbutyl]amino]propan-2-yl] 1-methylindole-3-carboxylate (PubChem CID 8817690) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is [(2R)-1-oxo-1-[[(1R)-1-phenylbutyl]amino]propan-2-yl] 1-methylindole-3-carboxylate.
| Compound Name | [(2R)-1-oxo-1-[[(1R)-1-phenylbutyl]amino]propan-2-yl] 1-methylindole-3-carboxylate |
|---|---|
| PubChem CID | 8817690 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | [(2R)-1-oxo-1-[[(1R)-1-phenylbutyl]amino]propan-2-yl] 1-methylindole-3-carboxylate |
| SMILES | CCC[C@@H](NC(=O)[C@@H](C)OC(=O)c1cn(C)c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C23H26N2O3/c1-4-10-20(17-11-6-5-7-12-17)24-22(26)16(2)28-23(27)19-15-25(3)21-14-9-8-13-18(19)21/h5-9,11-16,20H,4,10H2,1-3H3,(H,24,26)/t16-,20-/m1/s1 |
| InChIKey | ANKHOLWMLDGNDW-OXQOHEQNSA-N |
| XLogP | 4.38 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |