C18H25ClF3N3O+2 — CID 8818485
N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[4-(3-methylbut-2-enyl)piperazine-1,4-diium-1-yl]acetamide (PubChem CID 8818485) has the molecular formula C18H25ClF3N3O+2 and a molecular weight of 391.87 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[4-(3-methylbut-2-enyl)piperazine-1,4-diium-1-yl]acetamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[4-(3-methylbut-2-enyl)piperazine-1,4-diium-1-yl]acetamide |
|---|---|
| PubChem CID | 8818485 |
| Molecular Formula | C18H25ClF3N3O+2 |
| Molecular Weight | 391.87 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[4-(3-methylbut-2-enyl)piperazine-1,4-diium-1-yl]acetamide |
| SMILES | CC(C)=CC[NH+]1CC[NH+](CC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H23ClF3N3O/c1-13(2)5-6-24-7-9-25(10-8-24)12-17(26)23-14-3-4-16(19)15(11-14)18(20,21)22/h3-5,11H,6-10,12H2,1-2H3,(H,23,26)/p+2 |
| InChIKey | YEHQTANOJTYTRN-UHFFFAOYSA-P |
| XLogP | 1.05 |
| TPSA | 37.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.87 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|