C15H20N2O3S2 — CID 8818577
[2-[(2-methoxybenzoyl)amino]-2-oxoethyl] N,N-diethylcarbamodithioate (PubChem CID 8818577) has the molecular formula C15H20N2O3S2 and a molecular weight of 340.47 g/mol. Its IUPAC name is [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] N,N-diethylcarbamodithioate.
| Compound Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 8818577 |
| Molecular Formula | C15H20N2O3S2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCC(=O)NC(=O)c1ccccc1OC |
| InChI | InChI=1S/C15H20N2O3S2/c1-4-17(5-2)15(21)22-10-13(18)16-14(19)11-8-6-7-9-12(11)20-3/h6-9H,4-5,10H2,1-3H3,(H,16,18,19) |
| InChIKey | FBUMGMRDTAJBRS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|