About [(1S)-1-cyanoethyl] 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate
[(1S)-1-cyanoethyl] 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate (PubChem CID 8820486) has the molecular formula C19H14ClN3O2
and a molecular weight of 351.79 g/mol. Its IUPAC name is [(1S)-1-cyanoethyl] 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate.
Molecular Properties
| Compound Name | [(1S)-1-cyanoethyl] 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate |
| PubChem CID | 8820486 |
| Molecular Formula | C19H14ClN3O2 |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | [(1S)-1-cyanoethyl] 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate |
| SMILES | C[C@@H](C#N)OC(=O)c1cn(-c2ccccc2)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H14ClN3O2/c1-13(11-21)25-19(24)17-12-23(16-5-3-2-4-6-16)22-18(17)14-7-9-15(20)10-8-14/h2-10,12-13H,1H3/t13-/m0/s1 |
| InChIKey | TYKPJNYAICMCHY-ZDUSSCGKSA-N |
| XLogP | 4.26 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(1S)-1-cyanoethyl] 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-cyanoethyl] 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate?
The IUPAC name of [(1S)-1-cyanoethyl] 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate (CID 8820486) is [(1S)-1-cyanoethyl] 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate.
What is the SMILES notation for [(1S)-1-cyanoethyl] 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate?
The canonical SMILES for [(1S)-1-cyanoethyl] 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate is C[C@@H](C#N)OC(=O)c1cn(-c2ccccc2)nc1-c1ccc(Cl)cc1.
What is the InChIKey of [(1S)-1-cyanoethyl] 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate?
The InChIKey is TYKPJNYAICMCHY-ZDUSSCGKSA-N. The full InChI is InChI=1S/C19H14ClN3O2/c1-13(11-21)25-19(24)17-12-23(16-5-3-2-4-6-16)22-18(17)14-7-9-15(20)10-8-14/h2-10,12-13H,1H3/t13-/m0/s1.
What are the key properties of [(1S)-1-cyanoethyl] 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate?
[(1S)-1-cyanoethyl] 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate has a molecular weight of 351.79 g/mol, XLogP of 4.26, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-cyanoethyl] 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate is sourced from PubChem (CID 8820486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).