About (1-phenylethenylamino) 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate
(1-phenylethenylamino) 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate (PubChem CID 2339151) has the molecular formula C24H18ClN3O2
and a molecular weight of 415.88 g/mol. Its IUPAC name is (1-phenylethenylamino) 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate.
Molecular Properties
| Compound Name | (1-phenylethenylamino) 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate |
| PubChem CID | 2339151 |
| Molecular Formula | C24H18ClN3O2 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | (1-phenylethenylamino) 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate |
| SMILES | C=C(NOC(=O)c1cn(-c2ccccc2)nc1-c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H18ClN3O2/c1-17(18-8-4-2-5-9-18)27-30-24(29)22-16-28(21-10-6-3-7-11-21)26-23(22)19-12-14-20(25)15-13-19/h2-16,27H,1H2 |
| InChIKey | SZZIZKIWYJKNHE-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1-phenylethenylamino) 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-phenylethenylamino) 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate?
The IUPAC name of (1-phenylethenylamino) 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate (CID 2339151) is (1-phenylethenylamino) 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate.
What is the SMILES notation for (1-phenylethenylamino) 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate?
The canonical SMILES for (1-phenylethenylamino) 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate is C=C(NOC(=O)c1cn(-c2ccccc2)nc1-c1ccc(Cl)cc1)c1ccccc1.
What is the InChIKey of (1-phenylethenylamino) 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate?
The InChIKey is SZZIZKIWYJKNHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18ClN3O2/c1-17(18-8-4-2-5-9-18)27-30-24(29)22-16-28(21-10-6-3-7-11-21)26-23(22)19-12-14-20(25)15-13-19/h2-16,27H,1H2.
What are the key properties of (1-phenylethenylamino) 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate?
(1-phenylethenylamino) 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate has a molecular weight of 415.88 g/mol, XLogP of 5.53, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-phenylethenylamino) 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate is sourced from PubChem (CID 2339151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).