C18H15F2NO5S — CID 8821890
[2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 3-(3,4-difluorophenyl)sulfanylpropanoate (PubChem CID 8821890) has the molecular formula C18H15F2NO5S and a molecular weight of 395.38 g/mol. Its IUPAC name is [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 3-(3,4-difluorophenyl)sulfanylpropanoate.
| Compound Name | [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 3-(3,4-difluorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 8821890 |
| Molecular Formula | C18H15F2NO5S |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 3-(3,4-difluorophenyl)sulfanylpropanoate |
| SMILES | Cc1ccc(C(=O)COC(=O)CCSc2ccc(F)c(F)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H15F2NO5S/c1-11-2-3-12(8-16(11)21(24)25)17(22)10-26-18(23)6-7-27-13-4-5-14(19)15(20)9-13/h2-5,8-9H,6-7,10H2,1H3 |
| InChIKey | MUUXTSMZHHNELU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|