C15H20N4O5S — CID 8822984
2-(4-methoxyphenoxy)-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylacetohydrazide (PubChem CID 8822984) has the molecular formula C15H20N4O5S and a molecular weight of 368.42 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylacetohydrazide.
| Compound Name | 2-(4-methoxyphenoxy)-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 8822984 |
| Molecular Formula | C15H20N4O5S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 2-(4-methoxyphenoxy)-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylacetohydrazide |
| SMILES | COc1ccc(OCC(=O)NNS(=O)(=O)c2c(C)nn(C)c2C)cc1 |
| InChI | InChI=1S/C15H20N4O5S/c1-10-15(11(2)19(3)17-10)25(21,22)18-16-14(20)9-24-13-7-5-12(23-4)6-8-13/h5-8,18H,9H2,1-4H3,(H,16,20) |
| InChIKey | NZFPZXUZXGZYES-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|