C19H28N4O5S — CID 8823546
3-methoxy-4-(3-methylbutoxy)-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylbenzohydrazide (PubChem CID 8823546) has the molecular formula C19H28N4O5S and a molecular weight of 424.52 g/mol. Its IUPAC name is 3-methoxy-4-(3-methylbutoxy)-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylbenzohydrazide.
| Compound Name | 3-methoxy-4-(3-methylbutoxy)-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylbenzohydrazide |
|---|---|
| PubChem CID | 8823546 |
| Molecular Formula | C19H28N4O5S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 3-methoxy-4-(3-methylbutoxy)-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylbenzohydrazide |
| SMILES | COc1cc(C(=O)NNS(=O)(=O)c2c(C)nn(C)c2C)ccc1OCCC(C)C |
| InChI | InChI=1S/C19H28N4O5S/c1-12(2)9-10-28-16-8-7-15(11-17(16)27-6)19(24)20-22-29(25,26)18-13(3)21-23(5)14(18)4/h7-8,11-12,22H,9-10H2,1-6H3,(H,20,24) |
| InChIKey | FJGGSAPKZRYRFP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|