C20H16F2O3 — CID 8826795
(E)-1-(3,4-difluorophenyl)-3-(3-ethoxy-4-prop-2-ynoxyphenyl)prop-2-en-1-one (PubChem CID 8826795) has the molecular formula C20H16F2O3 and a molecular weight of 342.34 g/mol. Its IUPAC name is (E)-1-(3,4-difluorophenyl)-3-(3-ethoxy-4-prop-2-ynoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(3,4-difluorophenyl)-3-(3-ethoxy-4-prop-2-ynoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8826795 |
| Molecular Formula | C20H16F2O3 |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | (E)-1-(3,4-difluorophenyl)-3-(3-ethoxy-4-prop-2-ynoxyphenyl)prop-2-en-1-one |
| SMILES | C#CCOc1ccc(/C=C/C(=O)c2ccc(F)c(F)c2)cc1OCC |
| InChI | InChI=1S/C20H16F2O3/c1-3-11-25-19-10-6-14(12-20(19)24-4-2)5-9-18(23)15-7-8-16(21)17(22)13-15/h1,5-10,12-13H,4,11H2,2H3/b9-5+ |
| InChIKey | XONABPDWSCAKRA-WEVVVXLNSA-N |
| XLogP | 4.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|