C18H21N2O+ — CID 8827343
(2S)-1-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-(4-methylpyridin-1-ium-1-yl)propan-1-one (PubChem CID 8827343) has the molecular formula C18H21N2O+ and a molecular weight of 281.38 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-(4-methylpyridin-1-ium-1-yl)propan-1-one.
| Compound Name | (2S)-1-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-(4-methylpyridin-1-ium-1-yl)propan-1-one |
|---|---|
| PubChem CID | 8827343 |
| Molecular Formula | C18H21N2O+ |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | (2S)-1-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-(4-methylpyridin-1-ium-1-yl)propan-1-one |
| SMILES | Cc1cc[n+]([C@@H](C)C(=O)N2c3ccccc3C[C@@H]2C)cc1 |
| InChI | InChI=1S/C18H21N2O/c1-13-8-10-19(11-9-13)15(3)18(21)20-14(2)12-16-6-4-5-7-17(16)20/h4-11,14-15H,12H2,1-3H3/q+1/t14-,15-/m0/s1 |
| InChIKey | UNGYWUVPTMNPHL-GJZGRUSLSA-N |
| XLogP | 2.82 |
| TPSA | 24.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|