C20H25N2O+ — CID 8861967
(2S)-2-(5-ethyl-2-methylpyridin-1-ium-1-yl)-1-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propan-1-one (PubChem CID 8861967) has the molecular formula C20H25N2O+ and a molecular weight of 309.43 g/mol. Its IUPAC name is (2S)-2-(5-ethyl-2-methylpyridin-1-ium-1-yl)-1-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propan-1-one.
| Compound Name | (2S)-2-(5-ethyl-2-methylpyridin-1-ium-1-yl)-1-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propan-1-one |
|---|---|
| PubChem CID | 8861967 |
| Molecular Formula | C20H25N2O+ |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | (2S)-2-(5-ethyl-2-methylpyridin-1-ium-1-yl)-1-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propan-1-one |
| SMILES | CCc1ccc(C)[n+]([C@@H](C)C(=O)N2c3ccccc3C[C@H]2C)c1 |
| InChI | InChI=1S/C20H25N2O/c1-5-17-11-10-14(2)21(13-17)16(4)20(23)22-15(3)12-18-8-6-7-9-19(18)22/h6-11,13,15-16H,5,12H2,1-4H3/q+1/t15-,16+/m1/s1 |
| InChIKey | DUAYXTVTHRNNCZ-CVEARBPZSA-N |
| XLogP | 3.38 |
| TPSA | 24.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|