C24H23N2O2+ — CID 8858659
(2R)-2-(4-benzoylpyridin-1-ium-1-yl)-1-[(2S)-2-methyl-2,3-dihydroindol-1-yl]propan-1-one (PubChem CID 8858659) has the molecular formula C24H23N2O2+ and a molecular weight of 371.46 g/mol. Its IUPAC name is (2R)-2-(4-benzoylpyridin-1-ium-1-yl)-1-[(2S)-2-methyl-2,3-dihydroindol-1-yl]propan-1-one.
| Compound Name | (2R)-2-(4-benzoylpyridin-1-ium-1-yl)-1-[(2S)-2-methyl-2,3-dihydroindol-1-yl]propan-1-one |
|---|---|
| PubChem CID | 8858659 |
| Molecular Formula | C24H23N2O2+ |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | (2R)-2-(4-benzoylpyridin-1-ium-1-yl)-1-[(2S)-2-methyl-2,3-dihydroindol-1-yl]propan-1-one |
| SMILES | C[C@H](C(=O)N1c2ccccc2C[C@@H]1C)[n+]1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H23N2O2/c1-17-16-21-10-6-7-11-22(21)26(17)24(28)18(2)25-14-12-20(13-15-25)23(27)19-8-4-3-5-9-19/h3-15,17-18H,16H2,1-2H3/q+1/t17-,18+/m0/s1 |
| InChIKey | JRTRXTDDKQWCOO-ZWKOTPCHSA-N |
| XLogP | 3.74 |
| TPSA | 41.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|