C19H23N2O3+ — CID 8827969
propyl 4-[[2-(2,3-dimethylpyridin-1-ium-1-yl)acetyl]amino]benzoate (PubChem CID 8827969) has the molecular formula C19H23N2O3+ and a molecular weight of 327.40 g/mol. Its IUPAC name is propyl 4-[[2-(2,3-dimethylpyridin-1-ium-1-yl)acetyl]amino]benzoate.
| Compound Name | propyl 4-[[2-(2,3-dimethylpyridin-1-ium-1-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 8827969 |
| Molecular Formula | C19H23N2O3+ |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | propyl 4-[[2-(2,3-dimethylpyridin-1-ium-1-yl)acetyl]amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=O)C[n+]2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C19H22N2O3/c1-4-12-24-19(23)16-7-9-17(10-8-16)20-18(22)13-21-11-5-6-14(2)15(21)3/h5-11H,4,12-13H2,1-3H3/p+1 |
| InChIKey | JDEFQLQWHXKRFT-UHFFFAOYSA-O |
| XLogP | 2.80 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|