C18H23N2O+ — CID 8828216
(2S)-2-(2,3-dimethylpyridin-1-ium-1-yl)-N-ethyl-N-phenylpropanamide (PubChem CID 8828216) has the molecular formula C18H23N2O+ and a molecular weight of 283.39 g/mol. Its IUPAC name is (2S)-2-(2,3-dimethylpyridin-1-ium-1-yl)-N-ethyl-N-phenylpropanamide.
| Compound Name | (2S)-2-(2,3-dimethylpyridin-1-ium-1-yl)-N-ethyl-N-phenylpropanamide |
|---|---|
| PubChem CID | 8828216 |
| Molecular Formula | C18H23N2O+ |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | (2S)-2-(2,3-dimethylpyridin-1-ium-1-yl)-N-ethyl-N-phenylpropanamide |
| SMILES | CCN(C(=O)[C@H](C)[n+]1cccc(C)c1C)c1ccccc1 |
| InChI | InChI=1S/C18H23N2O/c1-5-19(17-11-7-6-8-12-17)18(21)16(4)20-13-9-10-14(2)15(20)3/h6-13,16H,5H2,1-4H3/q+1/t16-/m0/s1 |
| InChIKey | QLRLEXYFNIIZCK-INIZCTEOSA-N |
| XLogP | 3.21 |
| TPSA | 24.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|