C25H22FN3O2 — CID 8834218
N-ethyl-N-[(3-fluoro-4-methoxyphenyl)methyl]-2-pyridin-4-ylquinoline-4-carboxamide (PubChem CID 8834218) has the molecular formula C25H22FN3O2 and a molecular weight of 415.47 g/mol. Its IUPAC name is N-ethyl-N-[(3-fluoro-4-methoxyphenyl)methyl]-2-pyridin-4-ylquinoline-4-carboxamide.
| Compound Name | N-ethyl-N-[(3-fluoro-4-methoxyphenyl)methyl]-2-pyridin-4-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 8834218 |
| Molecular Formula | C25H22FN3O2 |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | N-ethyl-N-[(3-fluoro-4-methoxyphenyl)methyl]-2-pyridin-4-ylquinoline-4-carboxamide |
| SMILES | CCN(Cc1ccc(OC)c(F)c1)C(=O)c1cc(-c2ccncc2)nc2ccccc12 |
| InChI | InChI=1S/C25H22FN3O2/c1-3-29(16-17-8-9-24(31-2)21(26)14-17)25(30)20-15-23(18-10-12-27-13-11-18)28-22-7-5-4-6-19(20)22/h4-15H,3,16H2,1-2H3 |
| InChIKey | MGLAVCCAAIDJJI-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |