C23H27FN2O4 — CID 8848386
[2-(N-ethyl-4-fluoroanilino)-2-oxoethyl] (2S)-3-methyl-2-[(2-phenylacetyl)amino]butanoate (PubChem CID 8848386) has the molecular formula C23H27FN2O4 and a molecular weight of 414.48 g/mol. Its IUPAC name is [2-(N-ethyl-4-fluoroanilino)-2-oxoethyl] (2S)-3-methyl-2-[(2-phenylacetyl)amino]butanoate.
| Compound Name | [2-(N-ethyl-4-fluoroanilino)-2-oxoethyl] (2S)-3-methyl-2-[(2-phenylacetyl)amino]butanoate |
|---|---|
| PubChem CID | 8848386 |
| Molecular Formula | C23H27FN2O4 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | [2-(N-ethyl-4-fluoroanilino)-2-oxoethyl] (2S)-3-methyl-2-[(2-phenylacetyl)amino]butanoate |
| SMILES | CCN(C(=O)COC(=O)[C@@H](NC(=O)Cc1ccccc1)C(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H27FN2O4/c1-4-26(19-12-10-18(24)11-13-19)21(28)15-30-23(29)22(16(2)3)25-20(27)14-17-8-6-5-7-9-17/h5-13,16,22H,4,14-15H2,1-3H3,(H,25,27)/t22-/m0/s1 |
| InChIKey | QQBJLOUCVOLXDU-QFIPXVFZSA-N |
| XLogP | 3.11 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |