C17H23N3O6 — CID 8848578
[2-(2-acetylhydrazinyl)-2-oxoethyl] (2S)-3-methyl-2-[(2-phenoxyacetyl)amino]butanoate (PubChem CID 8848578) has the molecular formula C17H23N3O6 and a molecular weight of 365.39 g/mol. Its IUPAC name is [2-(2-acetylhydrazinyl)-2-oxoethyl] (2S)-3-methyl-2-[(2-phenoxyacetyl)amino]butanoate.
| Compound Name | [2-(2-acetylhydrazinyl)-2-oxoethyl] (2S)-3-methyl-2-[(2-phenoxyacetyl)amino]butanoate |
|---|---|
| PubChem CID | 8848578 |
| Molecular Formula | C17H23N3O6 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | [2-(2-acetylhydrazinyl)-2-oxoethyl] (2S)-3-methyl-2-[(2-phenoxyacetyl)amino]butanoate |
| SMILES | CC(=O)NNC(=O)COC(=O)[C@@H](NC(=O)COc1ccccc1)C(C)C |
| InChI | InChI=1S/C17H23N3O6/c1-11(2)16(17(24)26-10-15(23)20-19-12(3)21)18-14(22)9-25-13-7-5-4-6-8-13/h4-8,11,16H,9-10H2,1-3H3,(H,18,22)(H,19,21)(H,20,23)/t16-/m0/s1 |
| InChIKey | XDSNOWREJIRGHG-INIZCTEOSA-N |
| XLogP | -0.08 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|