C7H9NO2S — CID 88501595
4-methyl-6-sulfonylcyclohexa-2,4-dien-1-amine (PubChem CID 88501595) has the molecular formula C7H9NO2S and a molecular weight of 171.22 g/mol. Its IUPAC name is 4-methyl-6-sulfonylcyclohexa-2,4-dien-1-amine.
| Compound Name | 4-methyl-6-sulfonylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 88501595 |
| Molecular Formula | C7H9NO2S |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.04 |
| IUPAC Name | 4-methyl-6-sulfonylcyclohexa-2,4-dien-1-amine |
| SMILES | CC1=CC(=S(=O)=O)C(N)C=C1 |
| InChI | InChI=1S/C7H9NO2S/c1-5-2-3-6(8)7(4-5)11(9)10/h2-4,6H,8H2,1H3 |
| InChIKey | PTYDXJOQQHTMRX-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|