C20H26N2O5 — CID 88502200
tert-butyl N-[(2S)-1-[(2S)-2-(2-formylbenzoyl)pyrrolidin-1-yl]-1-oxopropan-2-yl]carbamate (PubChem CID 88502200) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[(2S)-2-(2-formylbenzoyl)pyrrolidin-1-yl]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[(2S)-2-(2-formylbenzoyl)pyrrolidin-1-yl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 88502200 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | tert-butyl N-[(2S)-1-[(2S)-2-(2-formylbenzoyl)pyrrolidin-1-yl]-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)C(=O)N1CCC[C@H]1C(=O)c1ccccc1C=O |
| InChI | InChI=1S/C20H26N2O5/c1-13(21-19(26)27-20(2,3)4)18(25)22-11-7-10-16(22)17(24)15-9-6-5-8-14(15)12-23/h5-6,8-9,12-13,16H,7,10-11H2,1-4H3,(H,21,26)/t13-,16-/m0/s1 |
| InChIKey | OGNMMVBVFIMUQY-BBRMVZONSA-N |
| XLogP | 2.59 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|