C13H32O5Si4 — CID 88504644
(hydroxy-methyl-trimethylsilyloxysilyl) 3-[dimethyl(trimethylsilyloxy)silyl]-2-methylprop-2-enoate (PubChem CID 88504644) has the molecular formula C13H32O5Si4 and a molecular weight of 380.74 g/mol. Its IUPAC name is (hydroxy-methyl-trimethylsilyloxysilyl) 3-[dimethyl(trimethylsilyloxy)silyl]-2-methylprop-2-enoate.
| Compound Name | (hydroxy-methyl-trimethylsilyloxysilyl) 3-[dimethyl(trimethylsilyloxy)silyl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88504644 |
| Molecular Formula | C13H32O5Si4 |
| Molecular Weight | 380.74 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | (hydroxy-methyl-trimethylsilyloxysilyl) 3-[dimethyl(trimethylsilyloxy)silyl]-2-methylprop-2-enoate |
| SMILES | CC(=C[Si](C)(C)O[Si](C)(C)C)C(=O)O[Si](C)(O)O[Si](C)(C)C |
| InChI | InChI=1S/C13H32O5Si4/c1-12(11-21(8,9)17-19(2,3)4)13(14)16-22(10,15)18-20(5,6)7/h11,15H,1-10H3 |
| InChIKey | RSIOWBDJGIZDPT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.74 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|