C16H25N3O2S — CID 88507037
ethyl (4aS,7R,8aS)-2-amino-5-propyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]thiazolo[4,5-g]quinoline-7-carboxylate (PubChem CID 88507037) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is ethyl (4aS,7R,8aS)-2-amino-5-propyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]thiazolo[4,5-g]quinoline-7-carboxylate.
| Compound Name | ethyl (4aS,7R,8aS)-2-amino-5-propyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]thiazolo[4,5-g]quinoline-7-carboxylate |
|---|---|
| PubChem CID | 88507037 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | ethyl (4aS,7R,8aS)-2-amino-5-propyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]thiazolo[4,5-g]quinoline-7-carboxylate |
| SMILES | CCCN1C[C@H](C(=O)OCC)C[C@H]2Cc3nc(N)sc3C[C@@H]21 |
| InChI | InChI=1S/C16H25N3O2S/c1-3-5-19-9-11(15(20)21-4-2)6-10-7-12-14(8-13(10)19)22-16(17)18-12/h10-11,13H,3-9H2,1-2H3,(H2,17,18)/t10-,11+,13-/m0/s1 |
| InChIKey | SFXILAYPJRDOTG-LOWVWBTDSA-N |
| XLogP | 2.10 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |