C17H26N4O2 — CID 90296656
ethyl (5aR,8R,9aR)-2-amino-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazoline-8-carboxylate (PubChem CID 90296656) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is ethyl (5aR,8R,9aR)-2-amino-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazoline-8-carboxylate.
| Compound Name | ethyl (5aR,8R,9aR)-2-amino-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazoline-8-carboxylate |
|---|---|
| PubChem CID | 90296656 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | ethyl (5aR,8R,9aR)-2-amino-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazoline-8-carboxylate |
| SMILES | CCCN1C[C@H](C(=O)OCC)C[C@@H]2Cc3nc(N)ncc3C[C@H]21 |
| InChI | InChI=1S/C17H26N4O2/c1-3-5-21-10-13(16(22)23-4-2)6-11-7-14-12(8-15(11)21)9-19-17(18)20-14/h9,11,13,15H,3-8,10H2,1-2H3,(H2,18,19,20)/t11-,13-,15-/m1/s1 |
| InChIKey | ZPHGJYSXDWCCQX-UXIGCNINSA-N |
| XLogP | 1.44 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |