C12H22NO3P — CID 88509026
ethyl (E)-5-[ethyl(methyl)phosphanyl]-2-formamido-4-methylpent-3-enoate (PubChem CID 88509026) has the molecular formula C12H22NO3P and a molecular weight of 259.29 g/mol. Its IUPAC name is ethyl (E)-5-[ethyl(methyl)phosphanyl]-2-formamido-4-methylpent-3-enoate.
| Compound Name | ethyl (E)-5-[ethyl(methyl)phosphanyl]-2-formamido-4-methylpent-3-enoate |
|---|---|
| PubChem CID | 88509026 |
| Molecular Formula | C12H22NO3P |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | ethyl (E)-5-[ethyl(methyl)phosphanyl]-2-formamido-4-methylpent-3-enoate |
| SMILES | CCOC(=O)C(/C=C(\C)CP(C)CC)NC=O |
| InChI | InChI=1S/C12H22NO3P/c1-5-16-12(15)11(13-9-14)7-10(3)8-17(4)6-2/h7,9,11H,5-6,8H2,1-4H3,(H,13,14)/b10-7+ |
| InChIKey | VHLRNGTUVRGUSX-JXMROGBWSA-N |
| XLogP | 1.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|