C19H28NO6P — CID 86745092
ethyl (E)-4-benzyl-5-diethoxyphosphoryl-2-formamidopent-3-enoate (PubChem CID 86745092) has the molecular formula C19H28NO6P and a molecular weight of 397.41 g/mol. Its IUPAC name is ethyl (E)-4-benzyl-5-diethoxyphosphoryl-2-formamidopent-3-enoate.
| Compound Name | ethyl (E)-4-benzyl-5-diethoxyphosphoryl-2-formamidopent-3-enoate |
|---|---|
| PubChem CID | 86745092 |
| Molecular Formula | C19H28NO6P |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | ethyl (E)-4-benzyl-5-diethoxyphosphoryl-2-formamidopent-3-enoate |
| SMILES | CCOC(=O)C(/C=C(\Cc1ccccc1)CP(=O)(OCC)OCC)NC=O |
| InChI | InChI=1S/C19H28NO6P/c1-4-24-19(22)18(20-15-21)13-17(12-16-10-8-7-9-11-16)14-27(23,25-5-2)26-6-3/h7-11,13,15,18H,4-6,12,14H2,1-3H3,(H,20,21)/b17-13+ |
| InChIKey | ODKWYRFYEHOQQC-GHRIWEEISA-N |
| XLogP | 3.10 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|