C22H34NO7P — CID 54347440
ethyl 4-[di(propan-2-yloxy)phosphorylmethyl]-2-formamido-5-phenylmethoxypent-3-enoate (PubChem CID 54347440) has the molecular formula C22H34NO7P and a molecular weight of 455.49 g/mol. Its IUPAC name is ethyl 4-[di(propan-2-yloxy)phosphorylmethyl]-2-formamido-5-phenylmethoxypent-3-enoate.
| Compound Name | ethyl 4-[di(propan-2-yloxy)phosphorylmethyl]-2-formamido-5-phenylmethoxypent-3-enoate |
|---|---|
| PubChem CID | 54347440 |
| Molecular Formula | C22H34NO7P |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | ethyl 4-[di(propan-2-yloxy)phosphorylmethyl]-2-formamido-5-phenylmethoxypent-3-enoate |
| SMILES | CCOC(=O)C(C=C(COCc1ccccc1)CP(=O)(OC(C)C)OC(C)C)NC=O |
| InChI | InChI=1S/C22H34NO7P/c1-6-28-22(25)21(23-16-24)12-20(14-27-13-19-10-8-7-9-11-19)15-31(26,29-17(2)3)30-18(4)5/h7-12,16-18,21H,6,13-15H2,1-5H3,(H,23,24) |
| InChIKey | UDHBNZAJPQGVJS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|