C13H18NO7P — CID 174469864
[dimethoxyphosphoryl(formamido)methyl] 2-phenylmethoxyacetate (PubChem CID 174469864) has the molecular formula C13H18NO7P and a molecular weight of 331.26 g/mol. Its IUPAC name is [dimethoxyphosphoryl(formamido)methyl] 2-phenylmethoxyacetate.
| Compound Name | [dimethoxyphosphoryl(formamido)methyl] 2-phenylmethoxyacetate |
|---|---|
| PubChem CID | 174469864 |
| Molecular Formula | C13H18NO7P |
| Molecular Weight | 331.26 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | [dimethoxyphosphoryl(formamido)methyl] 2-phenylmethoxyacetate |
| SMILES | COP(=O)(OC)C(NC=O)OC(=O)COCc1ccccc1 |
| InChI | InChI=1S/C13H18NO7P/c1-18-22(17,19-2)13(14-10-15)21-12(16)9-20-8-11-6-4-3-5-7-11/h3-7,10,13H,8-9H2,1-2H3,(H,14,15) |
| InChIKey | YYTRSRRQCGNUJH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|