C12H22NO6P — CID 54022303
ethyl 5-diethoxyphosphoryl-2-formamidopent-3-enoate (PubChem CID 54022303) has the molecular formula C12H22NO6P and a molecular weight of 307.28 g/mol. Its IUPAC name is ethyl 5-diethoxyphosphoryl-2-formamidopent-3-enoate.
| Compound Name | ethyl 5-diethoxyphosphoryl-2-formamidopent-3-enoate |
|---|---|
| PubChem CID | 54022303 |
| Molecular Formula | C12H22NO6P |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | ethyl 5-diethoxyphosphoryl-2-formamidopent-3-enoate |
| SMILES | CCOC(=O)C(C=CCP(=O)(OCC)OCC)NC=O |
| InChI | InChI=1S/C12H22NO6P/c1-4-17-12(15)11(13-10-14)8-7-9-20(16,18-5-2)19-6-3/h7-8,10-11H,4-6,9H2,1-3H3,(H,13,14) |
| InChIKey | KZTYKGBASWBOOO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|