About diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;ethyl hexyl hydrogen phosphate;zinc
diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;ethyl hexyl hydrogen phosphate;zinc (PubChem CID 88510705) has the molecular formula C16H39O9P3S2Zn
and a molecular weight of 597.93 g/mol. Its IUPAC name is diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;ethyl hexyl hydrogen phosphate;zinc.
Molecular Properties
| Compound Name | diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;ethyl hexyl hydrogen phosphate;zinc |
| PubChem CID | 88510705 |
| Molecular Formula | C16H39O9P3S2Zn |
| Molecular Weight | 597.93 g/mol |
| Exact Mass | 596.05 |
| IUPAC Name | diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;ethyl hexyl hydrogen phosphate;zinc |
| SMILES | CCCCCCOP(=O)(O)OCC.CCOP(=S)(OCC)OP(=S)(OCC)OCC.[Zn] |
| InChI | InChI=1S/C8H20O5P2S2.C8H19O4P.Zn/c1-5-9-14(16,10-6-2)13-15(17,11-7-3)12-8-4;1-3-5-6-7-8-12-13(9,10)11-4-2;/h5-8H2,1-4H3;3-8H2,1-2H3,(H,9,10); |
| InChIKey | VYKRHWMCLHFDJK-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 597.93 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;ethyl hexyl hydrogen phosphate;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;ethyl hexyl hydrogen phosphate;zinc?
The IUPAC name of diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;ethyl hexyl hydrogen phosphate;zinc (CID 88510705) is diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;ethyl hexyl hydrogen phosphate;zinc.
What is the SMILES notation for diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;ethyl hexyl hydrogen phosphate;zinc?
The canonical SMILES for diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;ethyl hexyl hydrogen phosphate;zinc is CCCCCCOP(=O)(O)OCC.CCOP(=S)(OCC)OP(=S)(OCC)OCC.[Zn].
What is the InChIKey of diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;ethyl hexyl hydrogen phosphate;zinc?
The InChIKey is VYKRHWMCLHFDJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20O5P2S2.C8H19O4P.Zn/c1-5-9-14(16,10-6-2)13-15(17,11-7-3)12-8-4;1-3-5-6-7-8-12-13(9,10)11-4-2;/h5-8H2,1-4H3;3-8H2,1-2H3,(H,9,10);.
What are the key properties of diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;ethyl hexyl hydrogen phosphate;zinc?
diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;ethyl hexyl hydrogen phosphate;zinc has a molecular weight of 597.93 g/mol, XLogP of 6.32, 18 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;ethyl hexyl hydrogen phosphate;zinc is sourced from PubChem (CID 88510705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).