C23H27F5N2O6 — CID 88511629
5-O-methyl 3-O-propan-2-yl (4R)-2-[2-(2-aminoethoxy)ethoxymethyl]-6-methyl-4-(2,3,4,5,6-pentafluorophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 88511629) has the molecular formula C23H27F5N2O6 and a molecular weight of 522.47 g/mol. Its IUPAC name is 5-O-methyl 3-O-propan-2-yl (4R)-2-[2-(2-aminoethoxy)ethoxymethyl]-6-methyl-4-(2,3,4,5,6-pentafluorophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-methyl 3-O-propan-2-yl (4R)-2-[2-(2-aminoethoxy)ethoxymethyl]-6-methyl-4-(2,3,4,5,6-pentafluorophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 88511629 |
| Molecular Formula | C23H27F5N2O6 |
| Molecular Weight | 522.47 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | 5-O-methyl 3-O-propan-2-yl (4R)-2-[2-(2-aminoethoxy)ethoxymethyl]-6-methyl-4-(2,3,4,5,6-pentafluorophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(COCCOCCN)=C(C(=O)OC(C)C)[C@@H]1c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C23H27F5N2O6/c1-10(2)36-23(32)14-12(9-35-8-7-34-6-5-29)30-11(3)13(22(31)33-4)15(14)16-17(24)19(26)21(28)20(27)18(16)25/h10,15,30H,5-9,29H2,1-4H3/t15-/m1/s1 |
| InChIKey | XSBCXHJTAAKLET-OAHLLOKOSA-N |
| XLogP | 2.71 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|