C13H13ClN4O3S — CID 88513092
[3-(5-chloropyrimidin-2-yl)oxy-4-methylanilino]sulfanyl N-methylcarbamate (PubChem CID 88513092) has the molecular formula C13H13ClN4O3S and a molecular weight of 340.79 g/mol. Its IUPAC name is [3-(5-chloropyrimidin-2-yl)oxy-4-methylanilino]sulfanyl N-methylcarbamate.
| Compound Name | [3-(5-chloropyrimidin-2-yl)oxy-4-methylanilino]sulfanyl N-methylcarbamate |
|---|---|
| PubChem CID | 88513092 |
| Molecular Formula | C13H13ClN4O3S |
| Molecular Weight | 340.79 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | [3-(5-chloropyrimidin-2-yl)oxy-4-methylanilino]sulfanyl N-methylcarbamate |
| SMILES | CNC(=O)OSNc1ccc(C)c(Oc2ncc(Cl)cn2)c1 |
| InChI | InChI=1S/C13H13ClN4O3S/c1-8-3-4-10(18-22-21-13(19)15-2)5-11(8)20-12-16-6-9(14)7-17-12/h3-7,18H,1-2H3,(H,15,19) |
| InChIKey | JNFHWFZRYVEZJM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.79 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|