C23H24ClN5O3 — CID 19900376
N-[[4-(5-chloropyrimidin-2-yl)oxy-3-methylphenyl]carbamoyl]-2-(diethylamino)benzamide (PubChem CID 19900376) has the molecular formula C23H24ClN5O3 and a molecular weight of 453.93 g/mol. Its IUPAC name is N-[[4-(5-chloropyrimidin-2-yl)oxy-3-methylphenyl]carbamoyl]-2-(diethylamino)benzamide.
| Compound Name | N-[[4-(5-chloropyrimidin-2-yl)oxy-3-methylphenyl]carbamoyl]-2-(diethylamino)benzamide |
|---|---|
| PubChem CID | 19900376 |
| Molecular Formula | C23H24ClN5O3 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | N-[[4-(5-chloropyrimidin-2-yl)oxy-3-methylphenyl]carbamoyl]-2-(diethylamino)benzamide |
| SMILES | CCN(CC)c1ccccc1C(=O)NC(=O)Nc1ccc(Oc2ncc(Cl)cn2)c(C)c1 |
| InChI | InChI=1S/C23H24ClN5O3/c1-4-29(5-2)19-9-7-6-8-18(19)21(30)28-22(31)27-17-10-11-20(15(3)12-17)32-23-25-13-16(24)14-26-23/h6-14H,4-5H2,1-3H3,(H2,27,28,30,31) |
| InChIKey | TZRNXGVSLQCKOW-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |