C20H18ClN5O5 — CID 21141269
2-[[3-(5-chloropyrimidin-2-yl)oxy-4-ethylphenyl]carbamoylcarbamoyl]-N-hydroxybenzeneamine oxide (PubChem CID 21141269) has the molecular formula C20H18ClN5O5 and a molecular weight of 443.85 g/mol. Its IUPAC name is 2-[[3-(5-chloropyrimidin-2-yl)oxy-4-ethylphenyl]carbamoylcarbamoyl]-N-hydroxybenzeneamine oxide.
| Compound Name | 2-[[3-(5-chloropyrimidin-2-yl)oxy-4-ethylphenyl]carbamoylcarbamoyl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 21141269 |
| Molecular Formula | C20H18ClN5O5 |
| Molecular Weight | 443.85 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 2-[[3-(5-chloropyrimidin-2-yl)oxy-4-ethylphenyl]carbamoylcarbamoyl]-N-hydroxybenzeneamine oxide |
| SMILES | CCc1ccc(NC(=O)NC(=O)c2ccccc2[NH+]([O-])O)cc1Oc1ncc(Cl)cn1 |
| InChI | InChI=1S/C20H18ClN5O5/c1-2-12-7-8-14(9-17(12)31-20-22-10-13(21)11-23-20)24-19(28)25-18(27)15-5-3-4-6-16(15)26(29)30/h3-11,26,29H,2H2,1H3,(H2,24,25,27,28) |
| InChIKey | KCNPJEFJEMNETG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 140.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.85 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|