C20H17BrN6O5 — CID 24834297
N-[[4-(5-bromopyrimidin-2-yl)oxy-3-nitrophenyl]carbamoyl]-2-(dimethylamino)benzamide (PubChem CID 24834297) has the molecular formula C20H17BrN6O5 and a molecular weight of 501.30 g/mol. Its IUPAC name is N-[[4-(5-bromopyrimidin-2-yl)oxy-3-nitrophenyl]carbamoyl]-2-(dimethylamino)benzamide.
| Compound Name | N-[[4-(5-bromopyrimidin-2-yl)oxy-3-nitrophenyl]carbamoyl]-2-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 24834297 |
| Molecular Formula | C20H17BrN6O5 |
| Molecular Weight | 501.30 g/mol |
| Exact Mass | 500.04 |
| IUPAC Name | N-[[4-(5-bromopyrimidin-2-yl)oxy-3-nitrophenyl]carbamoyl]-2-(dimethylamino)benzamide |
| SMILES | CN(C)c1ccccc1C(=O)NC(=O)Nc1ccc(Oc2ncc(Br)cn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H17BrN6O5/c1-26(2)15-6-4-3-5-14(15)18(28)25-19(29)24-13-7-8-17(16(9-13)27(30)31)32-20-22-10-12(21)11-23-20/h3-11H,1-2H3,(H2,24,25,28,29) |
| InChIKey | KMPFSUAWEXBLCM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.30 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|