C18H10BrClN6O7 — CID 15721590
N-[[4-(5-bromopyrimidin-2-yl)oxy-3-chlorophenyl]carbamoyl]-2,6-dinitrobenzamide (PubChem CID 15721590) has the molecular formula C18H10BrClN6O7 and a molecular weight of 537.67 g/mol. Its IUPAC name is N-[[4-(5-bromopyrimidin-2-yl)oxy-3-chlorophenyl]carbamoyl]-2,6-dinitrobenzamide.
| Compound Name | N-[[4-(5-bromopyrimidin-2-yl)oxy-3-chlorophenyl]carbamoyl]-2,6-dinitrobenzamide |
|---|---|
| PubChem CID | 15721590 |
| Molecular Formula | C18H10BrClN6O7 |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 535.95 |
| IUPAC Name | N-[[4-(5-bromopyrimidin-2-yl)oxy-3-chlorophenyl]carbamoyl]-2,6-dinitrobenzamide |
| SMILES | O=C(NC(=O)c1c([N+](=O)[O-])cccc1[N+](=O)[O-])Nc1ccc(Oc2ncc(Br)cn2)c(Cl)c1 |
| InChI | InChI=1S/C18H10BrClN6O7/c19-9-7-21-18(22-8-9)33-14-5-4-10(6-11(14)20)23-17(28)24-16(27)15-12(25(29)30)2-1-3-13(15)26(31)32/h1-8H,(H2,23,24,27,28) |
| InChIKey | PSYMWCKZUSKXGD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 179.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|