C28H31BrClN5O5 — CID 15132508
decyl (1Z)-N-[[4-(5-bromopyrimidin-2-yl)oxy-3-chlorophenyl]carbamoyl]-2-nitrobenzenecarboximidate (PubChem CID 15132508) has the molecular formula C28H31BrClN5O5 and a molecular weight of 632.94 g/mol. Its IUPAC name is decyl (1Z)-N-[[4-(5-bromopyrimidin-2-yl)oxy-3-chlorophenyl]carbamoyl]-2-nitrobenzenecarboximidate.
| Compound Name | decyl (1Z)-N-[[4-(5-bromopyrimidin-2-yl)oxy-3-chlorophenyl]carbamoyl]-2-nitrobenzenecarboximidate |
|---|---|
| PubChem CID | 15132508 |
| Molecular Formula | C28H31BrClN5O5 |
| Molecular Weight | 632.94 g/mol |
| Exact Mass | 631.12 |
| IUPAC Name | decyl (1Z)-N-[[4-(5-bromopyrimidin-2-yl)oxy-3-chlorophenyl]carbamoyl]-2-nitrobenzenecarboximidate |
| SMILES | CCCCCCCCCCO/C(=N\C(=O)Nc1ccc(Oc2ncc(Br)cn2)c(Cl)c1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H31BrClN5O5/c1-2-3-4-5-6-7-8-11-16-39-26(22-12-9-10-13-24(22)35(37)38)34-27(36)33-21-14-15-25(23(30)17-21)40-28-31-18-20(29)19-32-28/h9-10,12-15,17-19H,2-8,11,16H2,1H3,(H,33,36)/b34-26- |
| InChIKey | VNMMHCCBOJMAPZ-CLIDGEQKSA-N |
| XLogP | 8.73 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.94 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|