C22H16Cl2FN3O5 — CID 20520294
ethyl (1Z)-N-[[3-chloro-4-(3-chloro-4-nitrophenoxy)phenyl]carbamoyl]-2-fluorobenzenecarboximidate (PubChem CID 20520294) has the molecular formula C22H16Cl2FN3O5 and a molecular weight of 492.29 g/mol. Its IUPAC name is ethyl (1Z)-N-[[3-chloro-4-(3-chloro-4-nitrophenoxy)phenyl]carbamoyl]-2-fluorobenzenecarboximidate.
| Compound Name | ethyl (1Z)-N-[[3-chloro-4-(3-chloro-4-nitrophenoxy)phenyl]carbamoyl]-2-fluorobenzenecarboximidate |
|---|---|
| PubChem CID | 20520294 |
| Molecular Formula | C22H16Cl2FN3O5 |
| Molecular Weight | 492.29 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | ethyl (1Z)-N-[[3-chloro-4-(3-chloro-4-nitrophenoxy)phenyl]carbamoyl]-2-fluorobenzenecarboximidate |
| SMILES | CCO/C(=N\C(=O)Nc1ccc(Oc2ccc([N+](=O)[O-])c(Cl)c2)c(Cl)c1)c1ccccc1F |
| InChI | InChI=1S/C22H16Cl2FN3O5/c1-2-32-21(15-5-3-4-6-18(15)25)27-22(29)26-13-7-10-20(17(24)11-13)33-14-8-9-19(28(30)31)16(23)12-14/h3-12H,2H2,1H3,(H,26,29)/b27-21- |
| InChIKey | VVPNTCPXOPQWQY-MEFGMAGPSA-N |
| XLogP | 6.85 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.29 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|