C18H16BrN5O2 — CID 129194170
1-(2-aminophenyl)-3-[4-(5-bromopyrimidin-2-yl)oxy-3-methylphenyl]urea (PubChem CID 129194170) has the molecular formula C18H16BrN5O2 and a molecular weight of 414.26 g/mol. Its IUPAC name is 1-(2-aminophenyl)-3-[4-(5-bromopyrimidin-2-yl)oxy-3-methylphenyl]urea.
| Compound Name | 1-(2-aminophenyl)-3-[4-(5-bromopyrimidin-2-yl)oxy-3-methylphenyl]urea |
|---|---|
| PubChem CID | 129194170 |
| Molecular Formula | C18H16BrN5O2 |
| Molecular Weight | 414.26 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 1-(2-aminophenyl)-3-[4-(5-bromopyrimidin-2-yl)oxy-3-methylphenyl]urea |
| SMILES | Cc1cc(NC(=O)Nc2ccccc2N)ccc1Oc1ncc(Br)cn1 |
| InChI | InChI=1S/C18H16BrN5O2/c1-11-8-13(23-17(25)24-15-5-3-2-4-14(15)20)6-7-16(11)26-18-21-9-12(19)10-22-18/h2-10H,20H2,1H3,(H2,23,24,25) |
| InChIKey | HGQXWTIFCHBDRM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.26 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|