C19H17N5O3 — CID 129188553
2-amino-N-[(3-methyl-4-pyrazin-2-yloxyphenyl)carbamoyl]benzamide (PubChem CID 129188553) has the molecular formula C19H17N5O3 and a molecular weight of 363.38 g/mol. Its IUPAC name is 2-amino-N-[(3-methyl-4-pyrazin-2-yloxyphenyl)carbamoyl]benzamide.
| Compound Name | 2-amino-N-[(3-methyl-4-pyrazin-2-yloxyphenyl)carbamoyl]benzamide |
|---|---|
| PubChem CID | 129188553 |
| Molecular Formula | C19H17N5O3 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 2-amino-N-[(3-methyl-4-pyrazin-2-yloxyphenyl)carbamoyl]benzamide |
| SMILES | Cc1cc(NC(=O)NC(=O)c2ccccc2N)ccc1Oc1cnccn1 |
| InChI | InChI=1S/C19H17N5O3/c1-12-10-13(6-7-16(12)27-17-11-21-8-9-22-17)23-19(26)24-18(25)14-4-2-3-5-15(14)20/h2-11H,20H2,1H3,(H2,23,24,25,26) |
| InChIKey | CGEYBIHRGDPRQF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|