C19H16ClN5O5 — CID 21141267
2-[[4-(5-chloropyrimidin-2-yl)oxy-3-methylphenyl]carbamoylcarbamoyl]-N-hydroxybenzeneamine oxide (PubChem CID 21141267) has the molecular formula C19H16ClN5O5 and a molecular weight of 429.82 g/mol. Its IUPAC name is 2-[[4-(5-chloropyrimidin-2-yl)oxy-3-methylphenyl]carbamoylcarbamoyl]-N-hydroxybenzeneamine oxide.
| Compound Name | 2-[[4-(5-chloropyrimidin-2-yl)oxy-3-methylphenyl]carbamoylcarbamoyl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 21141267 |
| Molecular Formula | C19H16ClN5O5 |
| Molecular Weight | 429.82 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | 2-[[4-(5-chloropyrimidin-2-yl)oxy-3-methylphenyl]carbamoylcarbamoyl]-N-hydroxybenzeneamine oxide |
| SMILES | Cc1cc(NC(=O)NC(=O)c2ccccc2[NH+]([O-])O)ccc1Oc1ncc(Cl)cn1 |
| InChI | InChI=1S/C19H16ClN5O5/c1-11-8-13(6-7-16(11)30-19-21-9-12(20)10-22-19)23-18(27)24-17(26)14-4-2-3-5-15(14)25(28)29/h2-10,25,28H,1H3,(H2,23,24,26,27) |
| InChIKey | IGKLZQUWBIVJRC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 140.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.82 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|