C25H27Cl2N3O5 — CID 88514706
2-[4-[(2R)-2-[bis[2-(6-chloro-2-pyridinyl)-2-hydroxyethyl]amino]propyl]phenoxy]acetic acid (PubChem CID 88514706) has the molecular formula C25H27Cl2N3O5 and a molecular weight of 520.41 g/mol. Its IUPAC name is 2-[4-[(2R)-2-[bis[2-(6-chloro-2-pyridinyl)-2-hydroxyethyl]amino]propyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(2R)-2-[bis[2-(6-chloro-2-pyridinyl)-2-hydroxyethyl]amino]propyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 88514706 |
| Molecular Formula | C25H27Cl2N3O5 |
| Molecular Weight | 520.41 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | 2-[4-[(2R)-2-[bis[2-(6-chloro-2-pyridinyl)-2-hydroxyethyl]amino]propyl]phenoxy]acetic acid |
| SMILES | C[C@H](Cc1ccc(OCC(=O)O)cc1)N(CC(O)c1cccc(Cl)n1)CC(O)c1cccc(Cl)n1 |
| InChI | InChI=1S/C25H27Cl2N3O5/c1-16(12-17-8-10-18(11-9-17)35-15-25(33)34)30(13-21(31)19-4-2-6-23(26)28-19)14-22(32)20-5-3-7-24(27)29-20/h2-11,16,21-22,31-32H,12-15H2,1H3,(H,33,34)/t16-,21?,22?/m1/s1 |
| InChIKey | ILRKGPZUIBGXMH-NYYVNYEXSA-N |
| XLogP | 3.95 |
| TPSA | 116.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|