C33H37Cl2N3O4 — CID 88514711
1-(6-chloro-2-pyridinyl)-2-[[2-(6-chloro-2-pyridinyl)-2-hydroxyethyl]-[(2R)-1-[4-[2-(2-phenylethoxy)ethoxy]phenyl]propan-2-yl]amino]ethanol (PubChem CID 88514711) has the molecular formula C33H37Cl2N3O4 and a molecular weight of 610.58 g/mol. Its IUPAC name is 1-(6-chloro-2-pyridinyl)-2-[[2-(6-chloro-2-pyridinyl)-2-hydroxyethyl]-[(2R)-1-[4-[2-(2-phenylethoxy)ethoxy]phenyl]propan-2-yl]amino]ethanol.
| Compound Name | 1-(6-chloro-2-pyridinyl)-2-[[2-(6-chloro-2-pyridinyl)-2-hydroxyethyl]-[(2R)-1-[4-[2-(2-phenylethoxy)ethoxy]phenyl]propan-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 88514711 |
| Molecular Formula | C33H37Cl2N3O4 |
| Molecular Weight | 610.58 g/mol |
| Exact Mass | 609.22 |
| IUPAC Name | 1-(6-chloro-2-pyridinyl)-2-[[2-(6-chloro-2-pyridinyl)-2-hydroxyethyl]-[(2R)-1-[4-[2-(2-phenylethoxy)ethoxy]phenyl]propan-2-yl]amino]ethanol |
| SMILES | C[C@H](Cc1ccc(OCCOCCc2ccccc2)cc1)N(CC(O)c1cccc(Cl)n1)CC(O)c1cccc(Cl)n1 |
| InChI | InChI=1S/C33H37Cl2N3O4/c1-24(21-26-13-15-27(16-14-26)42-20-19-41-18-17-25-7-3-2-4-8-25)38(22-30(39)28-9-5-11-32(34)36-28)23-31(40)29-10-6-12-33(35)37-29/h2-16,24,30-31,39-40H,17-23H2,1H3/t24-,30?,31?/m1/s1 |
| InChIKey | ZLMZRGRZNKFGDM-XCZXHRDVSA-N |
| XLogP | 6.12 |
| TPSA | 87.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.58 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|