C30H38ClN3O6 — CID 88514732
2-[4-[(2S)-3-[[(2S)-2-(6-chloro-2-pyridinyl)-2-hydroxyethyl]-[2-[4-(2-ethoxyethoxy)phenyl]ethyl]amino]-2-hydroxypropoxy]phenyl]acetamide (PubChem CID 88514732) has the molecular formula C30H38ClN3O6 and a molecular weight of 572.10 g/mol. Its IUPAC name is 2-[4-[(2S)-3-[[(2S)-2-(6-chloro-2-pyridinyl)-2-hydroxyethyl]-[2-[4-(2-ethoxyethoxy)phenyl]ethyl]amino]-2-hydroxypropoxy]phenyl]acetamide.
| Compound Name | 2-[4-[(2S)-3-[[(2S)-2-(6-chloro-2-pyridinyl)-2-hydroxyethyl]-[2-[4-(2-ethoxyethoxy)phenyl]ethyl]amino]-2-hydroxypropoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 88514732 |
| Molecular Formula | C30H38ClN3O6 |
| Molecular Weight | 572.10 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | 2-[4-[(2S)-3-[[(2S)-2-(6-chloro-2-pyridinyl)-2-hydroxyethyl]-[2-[4-(2-ethoxyethoxy)phenyl]ethyl]amino]-2-hydroxypropoxy]phenyl]acetamide |
| SMILES | CCOCCOc1ccc(CCN(C[C@H](O)COc2ccc(CC(N)=O)cc2)C[C@H](O)c2cccc(Cl)n2)cc1 |
| InChI | InChI=1S/C30H38ClN3O6/c1-2-38-16-17-39-25-10-6-22(7-11-25)14-15-34(20-28(36)27-4-3-5-29(31)33-27)19-24(35)21-40-26-12-8-23(9-13-26)18-30(32)37/h3-13,24,28,35-36H,2,14-21H2,1H3,(H2,32,37)/t24-,28-/m0/s1 |
| InChIKey | WTGUDNSKPZHITH-CUBQBAPOSA-N |
| XLogP | 3.20 |
| TPSA | 127.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.10 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|