C29H31NO6 — CID 67933293
2-[4-[(2R)-2-[[2-(2-benzofuran-1-yl)-2-hydroxyethyl]-[(1R)-1-hydroxy-2-phenylethyl]amino]propyl]phenoxy]acetic acid (PubChem CID 67933293) has the molecular formula C29H31NO6 and a molecular weight of 489.57 g/mol. Its IUPAC name is 2-[4-[(2R)-2-[[2-(2-benzofuran-1-yl)-2-hydroxyethyl]-[(1R)-1-hydroxy-2-phenylethyl]amino]propyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(2R)-2-[[2-(2-benzofuran-1-yl)-2-hydroxyethyl]-[(1R)-1-hydroxy-2-phenylethyl]amino]propyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 67933293 |
| Molecular Formula | C29H31NO6 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 2-[4-[(2R)-2-[[2-(2-benzofuran-1-yl)-2-hydroxyethyl]-[(1R)-1-hydroxy-2-phenylethyl]amino]propyl]phenoxy]acetic acid |
| SMILES | C[C@H](Cc1ccc(OCC(=O)O)cc1)N(CC(O)c1occ2ccccc12)[C@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C29H31NO6/c1-20(15-22-11-13-24(14-12-22)35-19-28(33)34)30(27(32)16-21-7-3-2-4-8-21)17-26(31)29-25-10-6-5-9-23(25)18-36-29/h2-14,18,20,26-27,31-32H,15-17,19H2,1H3,(H,33,34)/t20-,26?,27-/m1/s1 |
| InChIKey | PVHPZNUPLQRKDM-JBUCIZAMSA-N |
| XLogP | 4.42 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|