C28H35NO5 — CID 67933235
(2S)-1-[[(2R)-1-[4-(2-hydroxyethoxy)phenyl]propan-2-yl]-[(1R)-1-hydroxy-2-phenylethyl]amino]-3-phenoxypropan-2-ol (PubChem CID 67933235) has the molecular formula C28H35NO5 and a molecular weight of 465.59 g/mol. Its IUPAC name is (2S)-1-[[(2R)-1-[4-(2-hydroxyethoxy)phenyl]propan-2-yl]-[(1R)-1-hydroxy-2-phenylethyl]amino]-3-phenoxypropan-2-ol.
| Compound Name | (2S)-1-[[(2R)-1-[4-(2-hydroxyethoxy)phenyl]propan-2-yl]-[(1R)-1-hydroxy-2-phenylethyl]amino]-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 67933235 |
| Molecular Formula | C28H35NO5 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | (2S)-1-[[(2R)-1-[4-(2-hydroxyethoxy)phenyl]propan-2-yl]-[(1R)-1-hydroxy-2-phenylethyl]amino]-3-phenoxypropan-2-ol |
| SMILES | C[C@H](Cc1ccc(OCCO)cc1)N(C[C@H](O)COc1ccccc1)[C@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C28H35NO5/c1-22(18-24-12-14-27(15-13-24)33-17-16-30)29(28(32)19-23-8-4-2-5-9-23)20-25(31)21-34-26-10-6-3-7-11-26/h2-15,22,25,28,30-32H,16-21H2,1H3/t22-,25+,28-/m1/s1 |
| InChIKey | GLSCLOATKCSVNW-MDQGVCTMSA-N |
| XLogP | 3.29 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|