C28H34N2O4 — CID 67933175
4-[(3R)-3-[[(2S)-2-hydroxy-3-phenoxypropyl]-[(1R)-1-hydroxy-2-phenylethyl]amino]butyl]benzamide (PubChem CID 67933175) has the molecular formula C28H34N2O4 and a molecular weight of 462.59 g/mol. Its IUPAC name is 4-[(3R)-3-[[(2S)-2-hydroxy-3-phenoxypropyl]-[(1R)-1-hydroxy-2-phenylethyl]amino]butyl]benzamide.
| Compound Name | 4-[(3R)-3-[[(2S)-2-hydroxy-3-phenoxypropyl]-[(1R)-1-hydroxy-2-phenylethyl]amino]butyl]benzamide |
|---|---|
| PubChem CID | 67933175 |
| Molecular Formula | C28H34N2O4 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 4-[(3R)-3-[[(2S)-2-hydroxy-3-phenoxypropyl]-[(1R)-1-hydroxy-2-phenylethyl]amino]butyl]benzamide |
| SMILES | C[C@H](CCc1ccc(C(N)=O)cc1)N(C[C@H](O)COc1ccccc1)[C@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C28H34N2O4/c1-21(12-13-22-14-16-24(17-15-22)28(29)33)30(27(32)18-23-8-4-2-5-9-23)19-25(31)20-34-26-10-6-3-7-11-26/h2-11,14-17,21,25,27,31-32H,12-13,18-20H2,1H3,(H2,29,33)/t21-,25+,27-/m1/s1 |
| InChIKey | MHBLJDUYYTXTFO-NKPLSRDGSA-N |
| XLogP | 3.41 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|