C31H39NO6 — CID 67933243
[(2S)-2-[[(2S)-2-hydroxy-3-phenoxypropyl]-[(1R)-1-hydroxy-2-phenylethyl]amino]butyl] 2-phenoxybutanoate (PubChem CID 67933243) has the molecular formula C31H39NO6 and a molecular weight of 521.65 g/mol. Its IUPAC name is [(2S)-2-[[(2S)-2-hydroxy-3-phenoxypropyl]-[(1R)-1-hydroxy-2-phenylethyl]amino]butyl] 2-phenoxybutanoate.
| Compound Name | [(2S)-2-[[(2S)-2-hydroxy-3-phenoxypropyl]-[(1R)-1-hydroxy-2-phenylethyl]amino]butyl] 2-phenoxybutanoate |
|---|---|
| PubChem CID | 67933243 |
| Molecular Formula | C31H39NO6 |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | [(2S)-2-[[(2S)-2-hydroxy-3-phenoxypropyl]-[(1R)-1-hydroxy-2-phenylethyl]amino]butyl] 2-phenoxybutanoate |
| SMILES | CCC(Oc1ccccc1)C(=O)OC[C@H](CC)N(C[C@H](O)COc1ccccc1)[C@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C31H39NO6/c1-3-25(22-37-31(35)29(4-2)38-28-18-12-7-13-19-28)32(30(34)20-24-14-8-5-9-15-24)21-26(33)23-36-27-16-10-6-11-17-27/h5-19,25-26,29-30,33-34H,3-4,20-23H2,1-2H3/t25-,26-,29?,30+/m0/s1 |
| InChIKey | ZFSRZDQMFXKUDG-DTNTYFDXSA-N |
| XLogP | 4.47 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|