C29H35NO5 — CID 19809079
1-[4-[2-[bis(2-hydroxy-3-phenoxypropyl)amino]propyl]phenyl]ethanone (PubChem CID 19809079) has the molecular formula C29H35NO5 and a molecular weight of 477.60 g/mol. Its IUPAC name is 1-[4-[2-[bis(2-hydroxy-3-phenoxypropyl)amino]propyl]phenyl]ethanone.
| Compound Name | 1-[4-[2-[bis(2-hydroxy-3-phenoxypropyl)amino]propyl]phenyl]ethanone |
|---|---|
| PubChem CID | 19809079 |
| Molecular Formula | C29H35NO5 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | 1-[4-[2-[bis(2-hydroxy-3-phenoxypropyl)amino]propyl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(CC(C)N(CC(O)COc2ccccc2)CC(O)COc2ccccc2)cc1 |
| InChI | InChI=1S/C29H35NO5/c1-22(17-24-13-15-25(16-14-24)23(2)31)30(18-26(32)20-34-28-9-5-3-6-10-28)19-27(33)21-35-29-11-7-4-8-12-29/h3-16,22,26-27,32-33H,17-21H2,1-2H3 |
| InChIKey | DPFYBELOVDOHJY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |