C28H36N2O4 — CID 67933185
2-[2-[1-[4-(1-aminoethoxy)phenyl]propan-2-yl-(2-hydroxy-3-phenoxypropyl)amino]ethyl]phenol (PubChem CID 67933185) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is 2-[2-[1-[4-(1-aminoethoxy)phenyl]propan-2-yl-(2-hydroxy-3-phenoxypropyl)amino]ethyl]phenol.
| Compound Name | 2-[2-[1-[4-(1-aminoethoxy)phenyl]propan-2-yl-(2-hydroxy-3-phenoxypropyl)amino]ethyl]phenol |
|---|---|
| PubChem CID | 67933185 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | 2-[2-[1-[4-(1-aminoethoxy)phenyl]propan-2-yl-(2-hydroxy-3-phenoxypropyl)amino]ethyl]phenol |
| SMILES | CC(N)Oc1ccc(CC(C)N(CCc2ccccc2O)CC(O)COc2ccccc2)cc1 |
| InChI | InChI=1S/C28H36N2O4/c1-21(18-23-12-14-27(15-13-23)34-22(2)29)30(17-16-24-8-6-7-11-28(24)32)19-25(31)20-33-26-9-4-3-5-10-26/h3-15,21-22,25,31-32H,16-20,29H2,1-2H3 |
| InChIKey | ZFGXJRAXKDIGBW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|